FL1CDFNS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|SysName=2'-Hydroxy-3,4,4',6'-tetramethoxychalcone | |SysName=2'-Hydroxy-3,4,4',6'-tetramethoxychalcone | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1CDF 3,4,2',4',6'-Pentahydroxychalcone O-methyl derivatives (3,4-Methoxy, without FL1CAF) (0 pages) : FL1CDFNS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 10496-67-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CDFNS0001.mol |
| 2'-Hydroxy-3,4,4',6'-tetramethoxychalcone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2'-Hydroxy-3,4,4',6'-tetramethoxychalcone |
| Common Name |
|
| Symbol | |
| Formula | C19H20O6 |
| Exact Mass | 344.125988372 |
| Average Mass | 344.3585 |
| SMILES | c(c1C(=O)C=Cc(c2)cc(OC)c(OC)c2)(O)cc(OC)cc1OC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
