FL1CG9NS0005
From Metabolomics.JP
(Difference between revisions)
| (5 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName= (E) -1- (Pentamethoxyphenyl) -3-phenyl-2-propen-1-one |
| − | |Common Name=&&Pedicellin && | + | |Common Name=&&Pedicellin&& (E) -1- (Pentamethoxyphenyl) -3-phenyl-2-propen-1-one&& |
|CAS=518-58-1 | |CAS=518-58-1 | ||
|KNApSAcK=C00006986 | |KNApSAcK=C00006986 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1CG9 (3),(5),2',3',4',5',6'-Hydroxychalcone and O-methyl derivatives (7 pages) : FL1CG9NS Simple substitution (4 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 518-58-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CG9NS0005.mol |
| Pedicellin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (E) -1- (Pentamethoxyphenyl) -3-phenyl-2-propen-1-one |
| Common Name |
|
| Symbol | |
| Formula | C20H22O6 |
| Exact Mass | 358.141638436 |
| Average Mass | 358.38508 |
| SMILES | O(C)c(c2OC)c(c(OC)c(c2OC)OC)C(=O)C=Cc(c1)cccc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
