FL3F3CNS0001
From Metabolomics.JP
(Difference between revisions)
| (3 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=2-(1,3-Benzodioxol-5-yl)-7,8-dimethoxy-4H-1-benzopyran-4-one | + | |SysName=2- (1,3-Benzodioxol-5-yl) -7,8-dimethoxy-4H-1-benzopyran-4-one |
| − | |Common Name=&&7,8-Dimethoxy-3',4'-methylenedioxyflavone&&2-(1,3-Benzodioxol-5-yl)-7,8-dimethoxy-4H-1-benzopyran-4-one&& | + | |Common Name=&&7,8-Dimethoxy-3',4'-methylenedioxyflavone&&2- (1,3-Benzodioxol-5-yl) -7,8-dimethoxy-4H-1-benzopyran-4-one&& |
|CAS=486430-44-8 | |CAS=486430-44-8 | ||
|KNApSAcK=C00013400 | |KNApSAcK=C00013400 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3F3C 7,8,3',4'-Tetrahydroxyflavone and O-methyl derivatives (0 pages) : FL3F3CNS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 486430-44-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3F3CNS0001.mol |
| 7,8-Dimethoxy-3',4'-methylenedioxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- (1,3-Benzodioxol-5-yl) -7,8-dimethoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C18H14O6 |
| Exact Mass | 326.07903818 |
| Average Mass | 326.30016 |
| SMILES | c(c41)(OCO4)ccc(C(O3)=CC(c(c32)ccc(c2OC)OC)=O)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
