FL3FAAGS0016
From Metabolomics.JP
(Difference between revisions)
| (3 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5,7,4'-Trihydroxyflavone 7-alpha-L-arabinofuranosyl-(1->6)-glucoside | + | |SysName=5,7,4'-Trihydroxyflavone 7-alpha-L-arabinofuranosyl- (1->6) -glucoside |
| − | |Common Name=&&Apigenin 7-alpha-L-arabinofuranosyl-(1->6)-glucoside&& | + | |Common Name=&&Apigenin 7-alpha-L-arabinofuranosyl- (1->6) -glucoside&&5,7,4'-Trihydroxyflavone 7-alpha-L-arabinofuranosyl- (1->6) -glucoside&& |
|CAS=111537-39-4 | |CAS=111537-39-4 | ||
|KNApSAcK=C00004151 | |KNApSAcK=C00004151 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FAA Apigenin (245 pages) : FL3FAAGS O-Glycoside (73 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 111537-39-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FAAGS0016.mol |
| Apigenin 7-alpha-L-arabinofuranosyl- (1->6) -glucoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,4'-Trihydroxyflavone 7-alpha-L-arabinofuranosyl- (1->6) -glucoside |
| Common Name |
|
| Symbol | |
| Formula | C26H28O14 |
| Exact Mass | 564.147905604 |
| Average Mass | 564.49212 |
| SMILES | C(C=4)(=O)c(c3OC4c(c5)ccc(c5)O)c(O)cc(c3)OC(C(O)1) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
