FL3FAAGS0038
From Metabolomics.JP
(Difference between revisions)
| (2 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5,7,4'-Trihydroxyflavone 5-(6"-malonylglucoside) | + | |SysName=5,7,4'-Trihydroxyflavone 5- (6"-malonylglucoside) |
| − | |Common Name=&&Apigenin 5-(6"-malonylglucoside)&&5,7,4'-Trihydroxyflavone 5-(6"-malonylglucoside)&& | + | |Common Name=&&Apigenin 5- (6"-malonylglucoside) &&5,7,4'-Trihydroxyflavone 5- (6"-malonylglucoside) && |
|CAS=130733-28-7 | |CAS=130733-28-7 | ||
|KNApSAcK=C00004174 | |KNApSAcK=C00004174 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FAA Apigenin (245 pages) : FL3FAAGS O-Glycoside (73 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 130733-28-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FAAGS0038.mol |
| Apigenin 5- (6"-malonylglucoside) | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,4'-Trihydroxyflavone 5- (6"-malonylglucoside) |
| Common Name |
|
| Symbol | |
| Formula | C24H22O13 |
| Exact Mass | 518.10604079 |
| Average Mass | 518.42368 |
| SMILES | O=C(CC(O)=O)OCC(C(O)4)OC(C(C(O)4)O)Oc(c12)cc(O)cc1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
