FL3FAANS0002
From Metabolomics.JP
(Difference between revisions)
| (5 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=5,7,4'-Trihydroxyflavone 7-lactate |
| − | |Common Name=&&Apigenin 7-lactate&& | + | |Common Name=&&Apigenin 7-lactate&&5,7,4'-Trihydroxyflavone 7-lactate&& |
|CAS=126462-89-3 | |CAS=126462-89-3 | ||
|KNApSAcK=C00004180 | |KNApSAcK=C00004180 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FAA Apigenin (245 pages) : FL3FAANS Simple substitution (3 pages) : FL3FAANS0 Normal (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 126462-89-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FAANS0002.mol |
| Apigenin 7-lactate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,4'-Trihydroxyflavone 7-lactate |
| Common Name |
|
| Symbol | |
| Formula | C18H14O7 |
| Exact Mass | 342.073952802 |
| Average Mass | 342.29956000000004 |
| SMILES | c(C(=C3)Oc(c2C(=O)3)cc(OC(=O)C(C)O)cc2O)(c1)ccc(O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
