FL3FADNI0002
From Metabolomics.JP
(Difference between revisions)
| (5 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=5,7-Dihydroxy-2- (4-hydroxy-3-methoxyphenyl) -6- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one |
| − | |Common Name= | + | |Common Name=&&6-Prenylchrysoeriol&&Cannflavin B&&Canniflavone&&Canniflavone 1&&5,7-Dihydroxy-2- (4-hydroxy-3-methoxyphenyl) -6- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one&& |
|CAS=76735-58-5 | |CAS=76735-58-5 | ||
|KNApSAcK=C00004036 | |KNApSAcK=C00004036 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FAD Chrysoeriol (62 pages) : FL3FADNI Non-cyclic prenyl substituted (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 76735-58-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FADNI0002.mol |
| 6-Prenylchrysoeriol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7-Dihydroxy-2- (4-hydroxy-3-methoxyphenyl) -6- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C21H20O6 |
| Exact Mass | 368.125988372 |
| Average Mass | 368.37989999999996 |
| SMILES | c(c1)(C(=C3)Oc(c2)c(C(=O)3)c(c(CC=C(C)C)c(O)2)O)cc |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
