FL3FCACS0010
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|SysName=5,4'-Dihydroxy-7-methoxyflavone 8-C- [ xylosyl- (1->2) -glucoside ] | |SysName=5,4'-Dihydroxy-7-methoxyflavone 8-C- [ xylosyl- (1->2) -glucoside ] | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FCA Genkwanin (48 pages) : FL3FCACS C-Glycoside (32 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 89613-14-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FCACS0010.mol |
| Isoswertisin 2"-O-xyloside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,4'-Dihydroxy-7-methoxyflavone 8-C- [ xylosyl- (1->2) -glucoside ] |
| Common Name |
|
| Symbol | |
| Formula | C27H30O14 |
| Exact Mass | 578.163555668 |
| Average Mass | 578.5187000000001 |
| SMILES | O(C)c(c3)c(c(O4)c(C(=O)C=C(c(c5)ccc(O)c5)4)c(O)3)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
