FL3FCKGS0004
From Metabolomics.JP
(Difference between revisions)
| (5 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=7-Methoxy-2- (3,4,5-trimethoxyphenyl) -5- [ (6-O-beta-D-xylopyranosyl-beta-D-glucopyranosyl) oxy ] -4H-1-benzopyran-4-one |
| − | |Common Name=&&Lethedioside B&&Tricetin 7,3',4',5'-trimethyl eter 5-xylosyl-(1->6)-glucoside&&7-Methoxy-2-(3,4,5-trimethoxyphenyl)-5-[(6-O-beta-D-xylopyranosyl-beta-D-glucopyranosyl)oxy]-4H-1-benzopyran-4-one&& | + | |Common Name=&&Lethedioside B&&Tricetin 7,3',4',5'-trimethyl eter 5-xylosyl- (1->6) -glucoside&&7-Methoxy-2- (3,4,5-trimethoxyphenyl) -5- [ (6-O-beta-D-xylopyranosyl-beta-D-glucopyranosyl) oxy ] -4H-1-benzopyran-4-one&& |
|CAS=221289-32-3 | |CAS=221289-32-3 | ||
|KNApSAcK=C00013722 | |KNApSAcK=C00013722 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FCK Tricetin O-methyl derivatives (5-Hydroxy-7-methoxy, without FL3FCG-FL3FCJ) (5 pages) : FL3FCKGS O-Glycoside (3 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 221289-32-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FCKGS0004.mol |
| Lethedioside B | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7-Methoxy-2- (3,4,5-trimethoxyphenyl) -5- [ (6-O-beta-D-xylopyranosyl-beta-D-glucopyranosyl) oxy ] -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C30H36O16 |
| Exact Mass | 652.200335104 |
| Average Mass | 652.59724 |
| SMILES | c(c1)(OC)cc(O4)c(C(=O)C=C4c(c5)cc(OC)c(c5OC)OC)c1O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
