FL5FACGL0015
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 15 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 6892-74-6 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5FACGL0015.mol |
Quercetin 3,7-diglucoside | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 2-(3,4-Dihydroxyphenyl)-3,7-bis(beta-D-glucopyranosyloxy)-5-hydroxy-4H-1-benzopyran-4-one |
Common Name |
|
Symbol | |
Formula | C27H30O17 |
Exact Mass | 626.148299534 |
Average Mass | 626.5169000000001 |
SMILES | O=C(c31)C(O[C@@H](C(O)5)O[C@@H]([C@@H](C(O)5)O)CO) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |