FL5FAHGL0001
From Metabolomics.JP
(Difference between revisions)
| (4 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=3- (beta-D-Glucopyranosyloxy) -3'-methoxy-4',5,5',7-tetrahydroxyflavone |
| − | |Common Name=&&Laricitrin 3-glucoside&& | + | |Common Name=&&Laricitrin 3-glucoside&&3- (beta-D-Glucopyranosyloxy) -3'-methoxy-4',5,5',7-tetrahydroxyflavone&& |
|CAS=39986-90-8 | |CAS=39986-90-8 | ||
|KNApSAcK=C00005761 | |KNApSAcK=C00005761 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FAH Laricitrin (12 pages) : FL5FAHGL 3-Glucoside and related (5 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 39986-90-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FAHGL0001.mol |
| Laricitrin 3-glucoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3- (beta-D-Glucopyranosyloxy) -3'-methoxy-4',5,5',7-tetrahydroxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C22H22O13 |
| Exact Mass | 494.10604078999995 |
| Average Mass | 494.40228 |
| SMILES | c(C(=O)1)(c4O)c(cc(c4)O)OC(c(c3)cc(OC)c(O)c(O)3)=C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
