FL1C1ANI0022
From Metabolomics.JP
(Difference between revisions)
| (4 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=3'- (2-Hydroxy-3-methylbut-3-enyl) -4,2',4'-trihydroxychalcone |
| − | |Common Name=&&3'-(2-Hydroxy-3-methylbut-3-enyl)-4,2',4'-trihydroxychalcone&& | + | |Common Name=&&3'- (2-Hydroxy-3-methylbut-3-enyl) -4,2',4'-trihydroxychalcone&& |
|CAS=- | |CAS=- | ||
|KNApSAcK=C00011139 | |KNApSAcK=C00011139 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1C1A Isoliquiritigenin and O-methyl derivatives (81 pages) : FL1C1ANI Non-cyclic prenyl substituted (33 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | - |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C1ANI0022.mol |
| 3'- (2-Hydroxy-3-methylbut-3-enyl) -4,2',4'-trihydroxychalcone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3'- (2-Hydroxy-3-methylbut-3-enyl) -4,2',4'-trihydroxychalcone |
| Common Name |
|
| Symbol | |
| Formula | C19H18O6 |
| Exact Mass | 342.110338308 |
| Average Mass | 342.34262 |
| SMILES | c(c1C(=O)C=Cc(c2)ccc(O)c2)(c(CC(O)C(C)=O)c(O)cc1)O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
