FL3FG9NS0004
From Metabolomics.JP
(Difference between revisions)
| Line 3: | Line 3: | ||
{{Metabolite | {{Metabolite | ||
|SysName=5,6,7,8-Tetramethoxy-2-phenyl-4H-1-benzopyran-4-one | |SysName=5,6,7,8-Tetramethoxy-2-phenyl-4H-1-benzopyran-4-one | ||
| − | |Common Name= | + | |Common Name=&&5,6,7,8-Tetramethoxyflavone&& |
|CAS=3162-43-4 | |CAS=3162-43-4 | ||
|KNApSAcK=C00003832 | |KNApSAcK=C00003832 | ||
}} | }} | ||
Latest revision as of 13:13, 6 August 2012
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FG9 5,6,7,8,(3'),(5')-Hydroxyflavone O-methyl derivatives (4 pages) : FL3FG9NS Simple substitution (4 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 3162-43-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FG9NS0004.mol |
| 5,6,7,8-Tetramethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,6,7,8-Tetramethoxy-2-phenyl-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C19H18O6 |
| Exact Mass | 342.110338308 |
| Average Mass | 342.34262 |
| SMILES | O(C=2c(c3)cccc3)c(c1OC)c(C(=O)C2)c(c(c1OC)OC)OC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
