FL3FGLNS0002
From Metabolomics.JP
(Difference between revisions)
| (3 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=2-(2,4-Dihydroxy-5-methoxyphenyl)-5-hydroxy-6,7,8-trimethoxy-4H-1-benzopyran-4-one | + | |SysName=2- (2,4-Dihydroxy-5-methoxyphenyl) -5-hydroxy-6,7,8-trimethoxy-4H-1-benzopyran-4-one |
| − | |Common Name=&&Agecorynin D&&2-(2,4-Dihydroxy-5-methoxyphenyl)-5-hydroxy-6,7,8-trimethoxy-4H-1-benzopyran-4-one&& | + | |Common Name=&&Agecorynin D&&2- (2,4-Dihydroxy-5-methoxyphenyl) -5-hydroxy-6,7,8-trimethoxy-4H-1-benzopyran-4-one&& |
|CAS=77053-48-6 | |CAS=77053-48-6 | ||
|KNApSAcK=C00003966 | |KNApSAcK=C00003966 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FGL 5,6,7,8,2',(3'),4',(5'),(6')-Hydroxyflavone O-methyl derivatives (8 pages) : FL3FGLNS Simple substitution (8 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 77053-48-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FGLNS0002.mol |
| Agecorynin D | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- (2,4-Dihydroxy-5-methoxyphenyl) -5-hydroxy-6,7,8-trimethoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C19H18O9 |
| Exact Mass | 390.095082174 |
| Average Mass | 390.34082 |
| SMILES | c(c(C(O2)=CC(c(c3O)c2c(c(c3OC)OC)OC)=O)1)(O)cc(O)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
