FL5FGCNS0001
From Metabolomics.JP
(Difference between revisions)
| (4 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=3,5,6,7,8,3',4'-Heptahydroxyflavone |
| − | |Common Name=&&8-Hydroxyquercetagetin && | + | |Common Name=&&8-Hydroxyquercetagetin&&3,5,6,7,8,3',4'-Heptahydroxyflavone&& |
|CAS=87926-83-8 | |CAS=87926-83-8 | ||
|KNApSAcK=C00004786 | |KNApSAcK=C00004786 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FGC 5,6,7,8,3',4'-Hexahydroxyflavonol and O-methyl derivatives (36 pages) : FL5FGCNS Simple substitution (28 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 87926-83-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FGCNS0001.mol |
| 8-Hydroxyquercetagetin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,6,7,8,3',4'-Heptahydroxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C15H10O9 |
| Exact Mass | 334.03248191800003 |
| Average Mass | 334.2345 |
| SMILES | Oc(c3)c(O)cc(c3)C(O1)=C(O)C(=O)c(c(O)2)c1c(O)c(O)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
