FL3FA9NS0003
From Metabolomics.JP
(Difference between revisions)
| Line 2: | Line 2: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5- | + | |SysName=5-Hydroxy-7-methoxyflavone |
| − | |Common Name= | + | |Common Name=&&5-Hydroxy-7-methoxyflavone&&Tectochrysin&& |
|CAS=520-28-5 | |CAS=520-28-5 | ||
|KNApSAcK=C00003795 | |KNApSAcK=C00003795 | ||
}} | }} | ||
Latest revision as of 13:44, 6 August 2012
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FA9 5,7,(3'),(5')-Hydroxyflavone O-methyl derivatives (53 pages) : FL3FA9NS Simple substitution (3 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 520-28-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FA9NS0003.mol |
| 5-Hydroxy-7-methoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5-Hydroxy-7-methoxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C16H12O4 |
| Exact Mass | 268.073558872 |
| Average Mass | 268.26408 |
| SMILES | COc(c3)cc(O1)c(c(O)3)C(=O)C=C1c(c2)cccc2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
