FL3FGANS0001
From Metabolomics.JP
(Difference between revisions)
| Line 3: | Line 3: | ||
{{Metabolite | {{Metabolite | ||
|SysName=2- (4-Methoxyphenyl) -5,7-dihydroxy-6,8-dimethoxy-4H-1-benzopyran-4-one | |SysName=2- (4-Methoxyphenyl) -5,7-dihydroxy-6,8-dimethoxy-4H-1-benzopyran-4-one | ||
| − | |Common Name=&&Nevadensin | + | |Common Name=&&Nevadensin&& |
|CAS=10176-66-6 | |CAS=10176-66-6 | ||
|KNApSAcK=C00001075 | |KNApSAcK=C00001075 | ||
}} | }} | ||
Latest revision as of 17:47, 1 February 2012
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FGA 5,6,7,8,4'-Pentahydroxyflavone and O-methyl derivatives (20 pages) : FL3FGANS Simple substitution (14 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 10176-66-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FGANS0001.mol |
| Nevadensin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- (4-Methoxyphenyl) -5,7-dihydroxy-6,8-dimethoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C18H16O7 |
| Exact Mass | 344.089602866 |
| Average Mass | 344.31543999999997 |
| SMILES | c(C(O2)=CC(c(c3O)c2c(c(c3OC)O)OC)=O)(c1)ccc(OC)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
