FL5FCDNS0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=Rhamnazin | + | |SysName=Rhamnazin |
|Common Name=&&Rhamnazin&&3,4',5-Trihydroxy-3',7-dimethoxyflavone&&7,3'-Di-O-methylquercetin&&3,5-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-4H-1-benzopyran-4-one&& | |Common Name=&&Rhamnazin&&3,4',5-Trihydroxy-3',7-dimethoxyflavone&&7,3'-Di-O-methylquercetin&&3,5-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-4H-1-benzopyran-4-one&& | ||
|CAS=552-54-5 | |CAS=552-54-5 | ||
|KNApSAcK=C00004642 | |KNApSAcK=C00004642 | ||
}} | }} |
Revision as of 09:00, 10 March 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 552-54-5 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5FCDNS0001.mol |
Rhamnazin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | Rhamnazin |
Common Name |
|
Symbol | |
Formula | C17H14O7 |
Exact Mass | 330.073952802 |
Average Mass | 330.28886 |
SMILES | COc(c3)cc(O1)c(c(O)3)C(=O)C(O)=C1c(c2)cc(OC)c(O)c2 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |