LBF20406PG01
From Metabolomics.JP
Upper classes
IDs and Links | |
---|---|
LipidBank | XPR1733 |
LipidMaps | LMFA03010051 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF20406PG01.mol |
15-deoxy-Delta^{12.14}-Prostaglandin D2 | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 9alpha-hydroxy-11-oxo-prosta-5Z,12E,14E-trien-1-oic acid |
Common Name |
|
Symbol | |
Formula | C20H30O4 |
Exact Mass | 334.21440944799997 |
Average Mass | 334.4498 |
SMILES | C([C@H]1CC=CCCCC(O)=O)(C(C[C@@H]1O)=O)=CC=CCCCCC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | lmax=296nm e296=18300 |
IR Spectra | |
NMR Spectra | |
Chromatograms | PGD2 and other metabolites are separated with HPLC. Please reffer following paper.<<2084>> |