LBF20406PG01
From Metabolomics.JP
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | XPR1733 |
| LipidMaps | LMFA03010051 |
| CAS | |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | LBF20406PG01.mol |
| 15-deoxy-Delta^{12.14}-Prostaglandin D2 | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 9alpha-hydroxy-11-oxo-prosta-5Z,12E,14E-trien-1-oic acid |
| Common Name |
|
| Symbol | |
| Formula | C20H30O4 |
| Exact Mass | 334.21440944799997 |
| Average Mass | 334.4498 |
| SMILES | C([C@H]1CC=CCCCC(O)=O)(C(C[C@@H]1O)=O)=CC=CCCCCC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | lmax=296nm e296=18300 |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | PGD2 and other metabolites are separated with HPLC. Please reffer following paper.<<2084>> |
