FL1C1ANP0002
From Metabolomics.JP
(Redirected from CAS:56083-03-5)
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1C1A Isoliquiritigenin and O-methyl derivatives (81 pages) : FL1C1ANP Pyranoflavonoid (19 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 52801-22-6,56083-03-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C1ANP0002.mol |
| 4-Hydroxylonchocarpin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 1- (2,2-Dimethyl-5-hydroxy-2H-1-benzopyran-6-yl) -3- (4-hydroxyphenyl) -2-propene-1-one |
| Common Name |
|
| Symbol | |
| Formula | C20H18O4 |
| Exact Mass | 322.120509064 |
| Average Mass | 322.35452 |
| SMILES | Oc(c3)ccc(c3)C=CC(c(c2O)ccc(c21)OC(C=C1)(C)C)=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
