FL1A3CGS0010
From Metabolomics.JP
				
								
				
				
																
				
				
								
				
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1A Aurone : FL1A3C Maritimetin and O-methyl derivatives (12 pages) : FL1A3CGS O-Glycoside (10 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 698392-68-6 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL1A3CGS0010.mol | 
| Bidenoside A | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | 6,7,3',4'-Tetrahydroxyaurone 6-O- (3",6"-di-O-acetylglucoside) | 
| Common Name | 
  | 
| Symbol | |
| Formula | C25H24O13 | 
| Exact Mass | 532.121690854 | 
| Average Mass | 532.45026 | 
| SMILES |  C(C1Oc(c(O)2)ccc(c(=O)3)c(oc3=Cc(c4)cc(c(O)c4)O)2) | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
  | 
