FL1BAAGS0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1B Auronol : FL1BAA Maesopsin (3 pages) : FL1BAAGS O-Glycoside (2 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 210050-28-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1BAAGS0001.mol |
| Hovetrichoside C | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2,4,6,4'-Tetrahydroxy-2-benzylcoumaranone 4-O-glucoside |
| Common Name |
|
| Symbol | |
| Formula | C21H22O11 |
| Exact Mass | 450.116211546 |
| Average Mass | 450.39278 |
| SMILES | C(C1Oc(c42)cc(O)cc(OC(O)(C4=O)Cc(c3)ccc(O)c3)2)(O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
