FL1DCFNS0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1D Dihydrochalcone : FL1DCF 2',6'-Dihydroxy-3,4,4'-trimethoxydihydrochalcone (0 pages) : FL1DCFNS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 157528-83-1 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1DCFNS0001.mol |
| 2',6'-Dihydroxy-3,4,4'-trimethoxydihydrochalcone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2',6'-Dihydroxy-3,4,4'-trimethoxydihydrochalcone |
| Common Name |
|
| Symbol | |
| Formula | C18H20O6 |
| Exact Mass | 332.125988372 |
| Average Mass | 332.3478 |
| SMILES | c(C(=O)CCc(c2)cc(OC)c(OC)c2)(c(O)1)c(O)cc(OC)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
