FL1DECNF0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1D Dihydrochalcone : FL1DEC 3,4,2',3',4',6'-Hexahydroxydihydrochalcone and O-methyl derivatives (0 pages) : FL1DECNF Furanoflavonoid (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 77985-80-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1DECNF0001.mol |
| 2'-Hydroxy-5',6'-dimethoxy-3,4-methylenedioxyfurano [ 2",3":4',3' ] dihydrochalcone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2'-Hydroxy-5',6'-dimethoxy-3,4-methylenedioxyfurano [ 2",3":4',3' ] dihydrochalcon |
| Common Name |
|
| Symbol | |
| Formula | C20H18O7 |
| Exact Mass | 370.10525293 |
| Average Mass | 370.35272 |
| SMILES | c(c34)cc(cc3OCO4)CCC(=O)c(c1O)c(c(c(o2)c(cc2)1)OC) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
