FL2F1ANI0007
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2F1A Liquiritigenin and O-methyl derivatives (43 pages) : FL2F1ANI Non-cyclic prenyl substituted (12 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 19879-30-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2F1ANI0007.mol |
| Bavachinin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (S) -2,3-Dihydro-2- (4-hydroxyphenyl) -7-methoxy-6- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C21H22O4 |
| Exact Mass | 338.151809192 |
| Average Mass | 338.39698 |
| SMILES | Oc(c1)ccc(C(C3)Oc(c2C(=O)3)cc(OC)c(c2)CC=C(C)C)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
