FL2F9ANS0002
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2F9A 7-Desoxyflavanone (4'-Hydroxy) and O-methyl derivatives (3 pages) : FL2F9ANS Simple substitution (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 123067-25-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2F9ANS0002.mol |
| 5,8,4'-Trihydroxyflavanone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,8,4'-Trihydroxyflavanone |
| Common Name |
|
| Symbol | |
| Formula | C15H12O5 |
| Exact Mass | 272.068473494 |
| Average Mass | 272.25278000000003 |
| SMILES | Oc(c3)ccc(c3)C(C1)Oc(c(O)2)c(c(O)cc2)C(=O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
