FL2FA8NS0006
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FA8 5,7,2',(3'),(5'),(6')-Hydroxyflavanone and O-methyl derivatives (25 pages) : FL2FA8NS Simple substitution (10 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 62346-19-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FA8NS0006.mol |
| Dihydroechioidinin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,2'-Dihydroxy-7-methoxyflavanone |
| Common Name |
|
| Symbol | |
| Formula | C16H14O5 |
| Exact Mass | 286.084123558 |
| Average Mass | 286.27936 |
| SMILES | COc(c3)cc(O1)c(c(O)3)C(=O)CC1c(c2)c(O)ccc2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
