FL4D1CGS0002
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL4 Dihydroflavonol : FL4D1C Fustin and O-methyl derivatives (6 pages) : FL4D1CGS O-Glycoside (2 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 114728-43-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL4D1CGS0002.mol |
| Fustin 7-rhamnoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,7,3',4'-Tetrahydroxyflavanone 7-rhamnoside |
| Common Name |
|
| Symbol | |
| Formula | C21H22O10 |
| Exact Mass | 434.121296924 |
| Average Mass | 434.39338 |
| SMILES | C(O1)(Oc(c4)cc(c2c4)OC(c(c3)cc(c(O)c3)O)C(C2=O)O)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
