FL4DA9NI0002
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL4 Dihydroflavonol : FL4DA9 5,7,(3'),(5')-Hydroxydihydroflavonol and O-methyl derivatives (25 pages) : FL4DA9NI Non-cyclic prenyl substituted (4 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 89648-66-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL4DA9NI0002.mol |
| (2R,3S) -3,5,7-Trihydroxy-6-prenylflavanone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2R,3S) -3,5,7-Trihydroxy-6-prenylflavanone |
| Common Name |
|
| Symbol | |
| Formula | C20H20O5 |
| Exact Mass | 340.13107375 |
| Average Mass | 340.3698 |
| SMILES | C(c(c3O)c(O)cc(c32)OC(C(C2=O)O)c(c1)cccc1)C=C(C)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
