FL4DFCNS0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL4 Dihydroflavonol : FL4DFC Dihydrogossypetin and O-methyl derivatives (1 pages) : FL4DFCNS Simple substitution (1 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 151193-57-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL4DFCNS0001.mol |
| Dihydrogossypetin 7,8-dimethyl ether | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,3',4'-Tetrahydroxy-7,8-dimethoxyflavanone |
| Common Name |
|
| Symbol | |
| Formula | C17H16O8 |
| Exact Mass | 348.08451748799996 |
| Average Mass | 348.30413999999996 |
| SMILES | COc(c3)c(OC)c(O1)c(c(O)3)C(=O)C(O)C1c(c2)cc(O)c(O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
