FL5F1CNS0005
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5F1C Fisetin and O-methyl derivatives (18 pages) : FL5F1CNS Simple substitution (6 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 58544-90-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5F1CNS0005.mol |
| Fisetin 7,3',4'-trimethyl ether | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3-Hydroxy-7,3',4'-trimethoxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C18H16O6 |
| Exact Mass | 328.094688244 |
| Average Mass | 328.31604 |
| SMILES | O(c23)C(=C(C(c2ccc(OC)c3)=O)O)c(c1)cc(OC)c(OC)c1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
