FL5FACGS0091
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FAC Quercetin (289 pages) : FL5FACGS O-Glycoside (Without 3-glycoside and 3-galactoside related) (126 pages) : FL5FACGS0 Normal (121 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 287384-26-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FACGS0091.mol |
| Quercetin 3- (6"-feruloylgalactoside) | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- (3,4-Dihydroxyphenyl) -5,7-dihydroxy-3- [ [ 6-O- [ (2E) -3- (4-hydroxy-3-methoxyphenyl) -1-oxo-2-propenyl ] -beta-D-galactopyranosyl ] oxy ] -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C31H28O15 |
| Exact Mass | 640.1428202259999 |
| Average Mass | 640.54502 |
| SMILES | O(C(COC(=O)C=Cc(c5)cc(c(O)c5)OC)4)C(C(C(C4O)O)O)OC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
