FL5FALNS0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FAL 5,7,2',(3'),4',(5'),(6')-Hydroxyflavonol and O-methyl derivatives (25 pages) : FL5FALNS Simple substitution (19 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 549-17-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FALNS0001.mol |
| Oxyayanin A | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- (2,5-Dihydroxy-4-methoxyphenyl) -5-hydroxy-3,7-dimethoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C18H16O8 |
| Exact Mass | 360.08451748799996 |
| Average Mass | 360.31484 |
| SMILES | c(c(C(O2)=C(C(c(c(O)3)c2cc(OC)c3)=O)OC)1)(O)cc(OC) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
