FL5FALNS0007
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FAL 5,7,2',(3'),4',(5'),(6')-Hydroxyflavonol and O-methyl derivatives (25 pages) : FL5FALNS Simple substitution (19 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 37751-25-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FALNS0007.mol |
| 5'-Hydroxymorin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,7,2',4',5'-Hexahydroxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C15H10O8 |
| Exact Mass | 318.037567296 |
| Average Mass | 318.2351 |
| SMILES | Oc(c3)cc(O1)c(c(O)3)C(=O)C(O)=C1c(c2)c(O)cc(O)c(O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
