FL5FDCGS0004
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FDC Quercetin O-methyl derivatives (3',4'-hydroxy, without FL5FBC, FL5FCC) (33 pages) : FL5FDCGS O-Glycoside (Without 3-glycoside and 3-galactoside related) (15 pages) : FL5FDCGS0 Normal (14 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 93373-14-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FDCGS0004.mol |
| 3-O-Methylquercetin 7-O-rhamnopyranoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7- [ (6-Deoxy-alpha-L-mannopyranosyl) oxy ] -2- (3,4-dihydroxyphenyl) -5-hydroxy-3-methoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C22H22O11 |
| Exact Mass | 462.116211546 |
| Average Mass | 462.40348000000006 |
| SMILES | Oc(c24)cc(cc2OC(=C(C4=O)OC)c(c3)ccc(c3O)O)OC(C1O)O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
