FL5FDEGS0002
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FDE Quercetin O-methyl derivatives (3'-hydroxy-4'-methoxy, without FL5FAE, FL5FBE, FL5FCE) (7 pages) : FL5FDEGS O-Glycoside (Without 3-glycoside and 3-galactoside related) (2 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | - |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FDEGS0002.mol |
| Quercetin 3,4'-dimethyl ether 7-alpha-L-Arabinofuranosyl- (1->6) -glucoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,3'-Trihydroxy-3,4'-dimethoxyflavone 7-alpha-L-Arabinofuranosyl- (1->6) -glucoside |
| Common Name |
|
| Symbol | |
| Formula | C28H32O16 |
| Exact Mass | 624.1690349759999 |
| Average Mass | 624.54408 |
| SMILES | c(c3)(cc(c(C(=O)4)c3OC(c(c5)cc(O)c(OC)c5)=C4OC)O)O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
