FL5FEAGS0021
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FEA 6-Hydroxykaempferol and O-methyl derivatives (74 pages) : FL5FEAGS O-Glycoside (Without 3-glycoside and 3-galactoside related) (25 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 205527-00-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FEAGS0021.mol |
| 5,6,7,4'-Tetrahydroxyflavonol 3-O-rutinoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3- [ [ 6-O- (6-Deoxy-alpha-L-mannopyranosyl) -beta-D-glucopyranosyl ] oxy ] -5,6,7-trihydroxy-2- (4-hydroxyphenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C27H30O16 |
| Exact Mass | 610.153384912 |
| Average Mass | 610.5175 |
| SMILES | C(=C(OC(O4)C(C(O)C(O)C4COC(O5)C(C(O)C(O)C5C)O)O)3) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
