FL5FFCNI0002
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FFC Gossypetin and O-methyl derivatives (94 pages) : FL5FFCNI Non-cyclic prenyl substituted (8 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 160036-26-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FFCNI0002.mol |
| 5,4'-Dihydroxy-3,8,3'-trimethoxy-7-prenyloxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,4'-Dihydroxy-3,8,3'-trimethoxy-7-prenyloxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C23H24O8 |
| Exact Mass | 428.14711774399996 |
| Average Mass | 428.43186000000003 |
| SMILES | O=C(c23)C(OC)=C(Oc2c(OC)c(cc(O)3)OCC=C(C)C)c(c1)cc |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
