FL5FFCNS0034
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FFC Gossypetin and O-methyl derivatives (94 pages) : FL5FFCNS Simple substitution (37 pages) : FL5FFCNS0 Normal (35 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 637774-70-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FFCNS0034.mol |
| 7,8,3',4'-Trihydroxy-3,5-dimethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- (3,4-Dihydroxyphenyl) -7,8-dihydroxy-3,5-dimethoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C17H14O8 |
| Exact Mass | 346.068867424 |
| Average Mass | 346.28826 |
| SMILES | COc(c1)c(C(=O)2)c(OC(c(c3)cc(O)c(O)c3)=C(OC)2)c(O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
