FL5FGANS0001
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FGA 5,6,7,8,4'-Pentahydroxyflavonol and O-methyl derivatives (16 pages) : FL5FGANS Simple substitution (9 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 102673-81-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FGANS0001.mol |
| 5,7,8,4'-Tetrahydroxy-3,6-dimethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,8,4'-Tetrahydroxy-3,6-dimethoxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C17H14O8 |
| Exact Mass | 346.068867424 |
| Average Mass | 346.28826 |
| SMILES | COc(c(O)1)c(O)c(C(=O)2)c(OC(c(c3)ccc(O)c3)=C(OC)2) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
