FL5FGCNS0008
From Metabolomics.JP
				
								
				
				
																
				
				
								
				
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FGC 5,6,7,8,3',4'-Hexahydroxyflavonol and O-methyl derivatives (36 pages) : FL5FGCNS Simple substitution (28 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 81943-52-4 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FGCNS0008.mol | 
| 5,3',4'-Trihydroxy-3,6,7,8-tetramethoxyflavone | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | 2- (3,4-Dihydroxyphenyl) -5-hydroxy-3,6,7,8-tetramethoxy-4H-1-benzopyran-4-one | 
| Common Name | 
  | 
| Symbol | |
| Formula | C19H18O9 | 
| Exact Mass | 390.095082174 | 
| Average Mass | 390.34082 | 
| SMILES |  c(C(O2)=C(C(c(c3O)c2c(c(c3OC)OC)OC)=O)OC)(c1)cc(O) | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
