FL5FGGNS0003
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FGG 5,6,7,8,3',4',5'-Heptahydroxyflavonol and O-methyl derivatives (17 pages) : FL5FGGNS Simple substitution (16 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 102673-82-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FGGNS0003.mol |
| 5,7,3',4'-Tetrahydroxy-3,6,8,5'-tetramethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,3',4'-Tetrahydroxy-3,6,8,5'-tetramethoxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C19H18O10 |
| Exact Mass | 406.089996796 |
| Average Mass | 406.34022000000004 |
| SMILES | O(C(c(c3)cc(OC)c(O)c(O)3)=1)c(c2OC)c(c(c(c2O)OC)O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
