FL5FGLNS0012
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FGL 5,6,7,8,2',(3'),4',(5'),(6')-Hydroxyflavonol and O-methyl derivatives (12 pages) : FL5FGLNS Simple substitution (12 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 113744-04-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FGLNS0012.mol |
| 5,7-Dihydroxy-3,6,8,2',4',5'-hexamethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7-Dihydroxy-3,6,8,2',4',5'-hexamethoxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C21H22O10 |
| Exact Mass | 434.121296924 |
| Average Mass | 434.39338 |
| SMILES | COc(c1)c(C(O3)=C(C(c(c32)c(c(c(O)c2OC)OC)O)=O)OC)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
