FL5FGLNS0013
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FGL 5,6,7,8,2',(3'),4',(5'),(6')-Hydroxyflavonol and O-methyl derivatives (12 pages) : FL5FGLNS Simple substitution (12 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 79105-52-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FGLNS0013.mol |
| Purpurascenin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,6,7,8,2',4',5'-Octamethoxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C23H26O10 |
| Exact Mass | 462.152597052 |
| Average Mass | 462.44654 |
| SMILES | O(C=2c(c(OC)3)cc(c(c3)OC)OC)c(c1C(=O)C(OC)2)c(OC)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
