FL63AGNN0002
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL6 Flavan : FL63 Flavan 3-ol : FL63AG Gallocatechin and Epigallocatechin (23 pages) : FL63AGNN Flavonophenylpropanoid (4 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 89013-65-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL63AGNN0002.mol |
| Epigallocatechin 3-O-p-coumarate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2R,3R) -3,5,7,3',4',5'-Hexahydroxyflavan 3-O-p-coumarate |
| Common Name |
|
| Symbol | |
| Formula | C24H20O9 |
| Exact Mass | 452.11073223799997 |
| Average Mass | 452.4102 |
| SMILES | O=C(C=Cc(c4)ccc(O)c4)OC(C2)C(c(c3)cc(c(c(O)3)O)O)O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
