FL6D3CNS0001
From Metabolomics.JP
				
								
				
				
																
				
				
								
				
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FL6 Flavan : FL6D Flavan 3,4-diol : FL6D3C Mesquitol 4-ol, Epimesquitol 4-ol and O-methyl derivatives (5 pages) : FL6D3CNS Simple substitution (5 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 38081-15-1 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL6D3CNS0001.mol | 
| Mesquitol-4beta-ol | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | (2R,3S,4S) -3,4,7,8,3',4'-Hexahydroxyflavan | 
| Common Name | 
  | 
| Symbol | |
| Formula | C15H14O7 | 
| Exact Mass | 306.073952802 | 
| Average Mass | 306.26746 | 
| SMILES | Oc(c3)c(O)cc(c3)C(O1)C(O)C(O)c(c2)c1c(O)c(O)c2 | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
  | 
