FL6F1ANS0002
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL6 Flavan : FL6F1A Cassiaflavan and O-methyl derivatives (7 pages) : FL6F1ANS Simple substitution (3 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 494-48-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL6F1ANS0002.mol |
| Cassiaflavan | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7,4'-Dihydroxyflavan |
| Common Name |
|
| Symbol | |
| Formula | C15H14O3 |
| Exact Mass | 242.094294314 |
| Average Mass | 242.26986000000002 |
| SMILES | Oc(c3)ccc(c3)C([H])(C1)Oc(c2)c(ccc(O)2)C1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
