FLIAALNI0002
From Metabolomics.JP
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIA Isoflavone : FLIAAL 5,7,2',(3'),4',(5'),(6')-Hydroxyisoflavone and O-methyl derivatives (59 pages) : FLIAALNI Non-cyclic prenyl substituted (21 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 41743-56-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIAALNI0002.mol |
| Luteone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3- (2,4-Dihydroxyphenyl) -5,7-dihydroxy-6- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C20H18O6 |
| Exact Mass | 354.110338308 |
| Average Mass | 354.35332 |
| SMILES | C(c(c(O)1)c(O)cc(O2)c1C(C(c(c3)c(O)cc(O)c3)=C2)=O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
