FLIAALNS0005
From Metabolomics.JP
				
								
				
				
																
				
				
								
				
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIA Isoflavone : FLIAAL 5,7,2',(3'),4',(5'),(6')-Hydroxyisoflavone and O-methyl derivatives (59 pages) : FLIAALNS Simple substitution (8 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 73428-16-7 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FLIAALNS0005.mol | 
| Derrugenin | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | 5,4'-Dihydroxy-7,2',5'-trimethoxyisoflavone | 
| Common Name | 
  | 
| Symbol | |
| Formula | C18H16O7 | 
| Exact Mass | 344.089602866 | 
| Average Mass | 344.31543999999997 | 
| SMILES | c(c13)(O)cc(OC)cc1OC=C(C3=O)c(c(OC)2)cc(OC)c(O)c2 | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
  | 
